C31H24ClN5O3 — CID 143806643
N-[2-[(1S)-5-aminooxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide (PubChem CID 143806643) has the molecular formula C31H24ClN5O3 and a molecular weight of 550.02 g/mol. Its IUPAC name is N-[2-[(1S)-5-aminooxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[(1S)-5-aminooxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143806643 |
| Molecular Formula | C31H24ClN5O3 |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-[2-[(1S)-5-aminooxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1H-indole-2-carboxamide |
| SMILES | NOc1cc2c(c3ccccc13)[C@H](CCl)CN2C(=O)c1cc2cc(NC(=O)c3cc4ccccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C31H24ClN5O3/c32-15-19-16-37(27-14-28(40-33)21-6-2-3-7-22(21)29(19)27)31(39)26-13-18-11-20(9-10-24(18)36-26)34-30(38)25-12-17-5-1-4-8-23(17)35-25/h1-14,19,35-36H,15-16,33H2,(H,34,38)/t19-/m1/s1 |
| InChIKey | IHFOBPWCCKKNAH-LJQANCHMSA-N |
| XLogP | 6.29 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|