C22H18ClN3O2 — CID 59365056
(5-amino-1H-indol-2-yl)-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]methanone (PubChem CID 59365056) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is (5-amino-1H-indol-2-yl)-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]methanone.
| Compound Name | (5-amino-1H-indol-2-yl)-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]methanone |
|---|---|
| PubChem CID | 59365056 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (5-amino-1H-indol-2-yl)-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]methanone |
| SMILES | Nc1ccc2[nH]c(C(=O)N3C[C@@H](CCl)c4c3cc(O)c3ccccc43)cc2c1 |
| InChI | InChI=1S/C22H18ClN3O2/c23-10-13-11-26(19-9-20(27)15-3-1-2-4-16(15)21(13)19)22(28)18-8-12-7-14(24)5-6-17(12)25-18/h1-9,13,25,27H,10-11,24H2/t13-/m1/s1 |
| InChIKey | HKBBKARGXLVLBE-CYBMUJFWSA-N |
| XLogP | 4.59 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|