C38H36ClN5O3S2 — CID 144636610
N-[2-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-5-[[(Z)-1-(methyldisulfanyl)hex-3-en-3-yl]amino]-1H-indole-2-carboxamide (PubChem CID 144636610) has the molecular formula C38H36ClN5O3S2 and a molecular weight of 710.33 g/mol. Its IUPAC name is N-[2-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-5-[[(Z)-1-(methyldisulfanyl)hex-3-en-3-yl]amino]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-5-[[(Z)-1-(methyldisulfanyl)hex-3-en-3-yl]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144636610 |
| Molecular Formula | C38H36ClN5O3S2 |
| Molecular Weight | 710.33 g/mol |
| Exact Mass | 709.19 |
| IUPAC Name | N-[2-[1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-5-[[(Z)-1-(methyldisulfanyl)hex-3-en-3-yl]amino]-1H-indole-2-carboxamide |
| SMILES | CC/C=C(/CCSSC)Nc1ccc2[nH]c(C(=O)Nc3ccc4[nH]c(C(=O)N5CC(CCl)c6c5cc(O)c5ccccc65)cc4c3)cc2c1 |
| InChI | InChI=1S/C38H36ClN5O3S2/c1-3-6-25(13-14-49-48-2)40-26-9-11-30-22(15-26)17-32(42-30)37(46)41-27-10-12-31-23(16-27)18-33(43-31)38(47)44-21-24(20-39)36-29-8-5-4-7-28(29)35(45)19-34(36)44/h4-12,15-19,24,40,42-43,45H,3,13-14,20-21H2,1-2H3,(H,41,46)/b25-6- |
| InChIKey | QHKBQLPLULTAFT-HGBQSQDTSA-N |
| XLogP | 9.85 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.33 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|