C22H16ClN3O4 — CID 11373546
[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-(6-nitro-1H-indol-2-yl)methanone (PubChem CID 11373546) has the molecular formula C22H16ClN3O4 and a molecular weight of 421.84 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-(6-nitro-1H-indol-2-yl)methanone.
| Compound Name | [(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-(6-nitro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 11373546 |
| Molecular Formula | C22H16ClN3O4 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]-(6-nitro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccc([N+](=O)[O-])cc2[nH]1)N1C[C@@H](CCl)c2c1cc(O)c1ccccc21 |
| InChI | InChI=1S/C22H16ClN3O4/c23-10-13-11-25(19-9-20(27)15-3-1-2-4-16(15)21(13)19)22(28)18-7-12-5-6-14(26(29)30)8-17(12)24-18/h1-9,13,24,27H,10-11H2/t13-/m1/s1 |
| InChIKey | HWNQBYCLPFOARB-CYBMUJFWSA-N |
| XLogP | 4.92 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|