C33H28ClN4O8- — CID 71431350
N-[1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 71431350) has the molecular formula C33H28ClN4O8- and a molecular weight of 644.06 g/mol. Its IUPAC name is N-[1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | N-[1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71431350 |
| Molecular Formula | C33H28ClN4O8- |
| Molecular Weight | 644.06 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | N-[1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | COc1cc2cc(C(=O)N3CC(CCl)c4c3cc(N(Cc3ccc([N+](=O)[O-])cc3)C(=O)[O-])c3ccccc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C33H29ClN4O8/c1-44-27-13-19-12-24(35-29(19)31(46-3)30(27)45-2)32(39)36-17-20(15-34)28-23-7-5-4-6-22(23)25(14-26(28)36)37(33(40)41)16-18-8-10-21(11-9-18)38(42)43/h4-14,20,35H,15-17H2,1-3H3,(H,40,41)/p-1 |
| InChIKey | NBGRSMMVLGSUHM-UHFFFAOYSA-M |
| XLogP | 5.59 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.06 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|