C25H24N4O9 — CID 10577983
methyl 8-(hydroxymethyl)-4-nitro-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 10577983) has the molecular formula C25H24N4O9 and a molecular weight of 524.49 g/mol. Its IUPAC name is methyl 8-(hydroxymethyl)-4-nitro-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl 8-(hydroxymethyl)-4-nitro-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 10577983 |
| Molecular Formula | C25H24N4O9 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | methyl 8-(hydroxymethyl)-4-nitro-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c3c(cc([N+](=O)[O-])c2[nH]1)N(C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1)CC3CO |
| InChI | InChI=1S/C25H24N4O9/c1-35-18-6-11-5-14(26-20(11)23(37-3)22(18)36-2)24(31)28-9-12(10-30)19-13-7-15(25(32)38-4)27-21(13)17(29(33)34)8-16(19)28/h5-8,12,26-27,30H,9-10H2,1-4H3 |
| InChIKey | ALBYZHPKGIWYMA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|