C35H45N4O13PS — CID 57342366
ditert-butyl 2-[[1-(hydroxymethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl phosphate (PubChem CID 57342366) has the molecular formula C35H45N4O13PS and a molecular weight of 792.80 g/mol. Its IUPAC name is ditert-butyl 2-[[1-(hydroxymethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl phosphate.
| Compound Name | ditert-butyl 2-[[1-(hydroxymethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl phosphate |
|---|---|
| PubChem CID | 57342366 |
| Molecular Formula | C35H45N4O13PS |
| Molecular Weight | 792.80 g/mol |
| Exact Mass | 792.24 |
| IUPAC Name | ditert-butyl 2-[[1-(hydroxymethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl phosphate |
| SMILES | COc1cc2cc(C(=O)N3CC(CO)c4c3cc([N+](=O)[O-])c3cc(S(=O)(=O)NCCOP(=O)(OC(C)(C)C)OC(C)(C)C)ccc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C35H45N4O13PS/c1-34(2,3)51-53(44,52-35(4,5)6)50-13-12-36-54(45,46)22-10-11-23-24(16-22)26(39(42)43)17-27-29(23)21(19-40)18-38(27)33(41)25-14-20-15-28(47-7)31(48-8)32(49-9)30(20)37-25/h10-11,14-17,21,36-37,40H,12-13,18-19H2,1-9H3 |
| InChIKey | LTRTUACQXVQNRZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 218.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|