C49H42Cl2N10O13S2 — CID 42602104
1,3-bis[2-[1-(chloromethyl)-7-(2-hydroxyethylsulfamoyl)-5-nitro-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]urea (PubChem CID 42602104) has the molecular formula C49H42Cl2N10O13S2 and a molecular weight of 1113.97 g/mol. Its IUPAC name is 1,3-bis[2-[1-(chloromethyl)-7-(2-hydroxyethylsulfamoyl)-5-nitro-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]urea.
| Compound Name | 1,3-bis[2-[1-(chloromethyl)-7-(2-hydroxyethylsulfamoyl)-5-nitro-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 42602104 |
| Molecular Formula | C49H42Cl2N10O13S2 |
| Molecular Weight | 1113.97 g/mol |
| Exact Mass | 1112.18 |
| IUPAC Name | 1,3-bis[2-[1-(chloromethyl)-7-(2-hydroxyethylsulfamoyl)-5-nitro-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]urea |
| SMILES | O=C(Nc1ccc2[nH]c(C(=O)N3CC(CCl)c4c3cc([N+](=O)[O-])c3cc(S(=O)(=O)NCCO)ccc43)cc2c1)Nc1ccc2[nH]c(C(=O)N3CC(CCl)c4c3cc([N+](=O)[O-])c3cc(S(=O)(=O)NCCO)ccc43)cc2c1 |
| InChI | InChI=1S/C49H42Cl2N10O13S2/c50-21-27-23-58(43-19-41(60(67)68)35-17-31(3-5-33(35)45(27)43)75(71,72)52-9-11-62)47(64)39-15-25-13-29(1-7-37(25)56-39)54-49(66)55-30-2-8-38-26(14-30)16-40(57-38)48(65)59-24-28(22-51)46-34-6-4-32(76(73,74)53-10-12-63)18-36(34)42(61(69)70)20-44(46)59/h1-8,13-20,27-28,52-53,56-57,62-63H,9-12,21-24H2,(H2,54,55,66) |
| InChIKey | WOMSIJOIANQMMY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 332.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 76 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.97 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|