C28H30BClN6O7S — CID 59725619
CID 59725619 (PubChem CID 59725619) has the molecular formula C28H30BClN6O7S and a molecular weight of 640.92 g/mol.
| Compound Name | CID 59725619 |
|---|---|
| PubChem CID | 59725619 |
| Molecular Formula | C28H30BClN6O7S |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | — |
| SMILES | [B]C(NNS(=O)(=O)c1ccc2c3c(cc([N+](=O)[O-])c2c1)N(C(=O)c1cc2cc(OCCN(C)C)ccc2[nH]1)CC3CCl)OC |
| InChI | InChI=1S/C28H30BClN6O7S/c1-34(2)8-9-43-18-4-7-22-16(10-18)11-23(31-22)27(37)35-15-17(14-30)26-20-6-5-19(44(40,41)33-32-28(29)42-3)12-21(20)24(36(38)39)13-25(26)35/h4-7,10-13,17,28,31-33H,8-9,14-15H2,1-3H3 |
| InChIKey | UGVKGRIPXONOOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|