C30H34ClN5O6S — CID 46184953
(1S)-5-amino-1-(chloromethyl)-N-(2-hydroxyethyl)-3-[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indole-7-sulfonamide (PubChem CID 46184953) has the molecular formula C30H34ClN5O6S and a molecular weight of 628.15 g/mol. Its IUPAC name is (1S)-5-amino-1-(chloromethyl)-N-(2-hydroxyethyl)-3-[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indole-7-sulfonamide.
| Compound Name | (1S)-5-amino-1-(chloromethyl)-N-(2-hydroxyethyl)-3-[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indole-7-sulfonamide |
|---|---|
| PubChem CID | 46184953 |
| Molecular Formula | C30H34ClN5O6S |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | (1S)-5-amino-1-(chloromethyl)-N-(2-hydroxyethyl)-3-[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indole-7-sulfonamide |
| SMILES | Nc1cc2c(c3ccc(S(=O)(=O)NCCO)cc13)[C@H](CCl)CN2C(=O)c1cc2cc(OCCN3CCOCC3)ccc2[nH]1 |
| InChI | InChI=1S/C30H34ClN5O6S/c31-17-20-18-36(28-16-25(32)24-15-22(2-3-23(24)29(20)28)43(39,40)33-5-9-37)30(38)27-14-19-13-21(1-4-26(19)34-27)42-12-8-35-6-10-41-11-7-35/h1-4,13-16,20,33-34,37H,5-12,17-18,32H2/t20-/m1/s1 |
| InChIKey | QRCHTTAZCRRBEC-HXUWFJFHSA-N |
| XLogP | 2.87 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|