C27H26BClN6O7S — CID 59303208
CID 59303208 (PubChem CID 59303208) has the molecular formula C27H26BClN6O7S and a molecular weight of 624.87 g/mol.
| Compound Name | CID 59303208 |
|---|---|
| PubChem CID | 59303208 |
| Molecular Formula | C27H26BClN6O7S |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NNS(=O)(=O)c1ccc2c3c(cc([N+](=O)[O-])c2c1)N(C(=O)c1cc2cc(OCCN(C)C)ccc2[nH]1)CC3CCl |
| InChI | InChI=1S/C27H26BClN6O7S/c1-33(2)7-8-42-17-3-6-21-15(9-17)10-22(30-21)26(36)34-14-16(13-29)25-19-5-4-18(43(40,41)32-31-27(28)37)11-20(19)23(35(38)39)12-24(25)34/h3-6,9-12,16,30,32H,7-8,13-14H2,1-2H3,(H,31,37) |
| InChIKey | JBEXNKSXZCEHEL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|