C27H28BrN4O12PS — CID 54753792
2-[[1-(bromomethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate (PubChem CID 54753792) has the molecular formula C27H28BrN4O12PS and a molecular weight of 743.48 g/mol. Its IUPAC name is 2-[[1-(bromomethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate.
| Compound Name | 2-[[1-(bromomethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54753792 |
| Molecular Formula | C27H28BrN4O12PS |
| Molecular Weight | 743.48 g/mol |
| Exact Mass | 742.03 |
| IUPAC Name | 2-[[1-(bromomethyl)-5-nitro-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate |
| SMILES | COc1cc2cc(C(=O)N3CC(CBr)c4c3cc([N+](=O)[O-])c3cc(S(=O)(=O)NCCOP(=O)(O)O)ccc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C27H28BrN4O12PS/c1-41-22-9-14-8-19(30-24(14)26(43-3)25(22)42-2)27(33)31-13-15(12-28)23-17-5-4-16(10-18(17)20(32(34)35)11-21(23)31)46(39,40)29-6-7-44-45(36,37)38/h4-5,8-11,15,29-30H,6-7,12-13H2,1-3H3,(H2,36,37,38) |
| InChIKey | SSDTVEAQALBQFQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 219.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|