C32H35BrN4O9 — CID 10394967
methyl (2R,8S)-8-(bromomethyl)-2-methyl-1-oxo-4-(piperidine-1-carbonyloxy)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 10394967) has the molecular formula C32H35BrN4O9 and a molecular weight of 699.55 g/mol. Its IUPAC name is methyl (2R,8S)-8-(bromomethyl)-2-methyl-1-oxo-4-(piperidine-1-carbonyloxy)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl (2R,8S)-8-(bromomethyl)-2-methyl-1-oxo-4-(piperidine-1-carbonyloxy)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 10394967 |
| Molecular Formula | C32H35BrN4O9 |
| Molecular Weight | 699.55 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | methyl (2R,8S)-8-(bromomethyl)-2-methyl-1-oxo-4-(piperidine-1-carbonyloxy)-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)Nc2c(OC(=O)N3CCCCC3)cc3c(c2C1=O)[C@H](CBr)CN3C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1 |
| InChI | InChI=1S/C32H35BrN4O9/c1-32(30(40)45-5)28(38)23-22-17(14-33)15-37(19(22)13-20(25(23)35-32)46-31(41)36-9-7-6-8-10-36)29(39)18-11-16-12-21(42-2)26(43-3)27(44-4)24(16)34-18/h11-13,17,34-35H,6-10,14-15H2,1-5H3/t17-,32-/m1/s1 |
| InChIKey | PNLRCOJROTWFSJ-HYJWCJBQSA-N |
| XLogP | 4.86 |
| TPSA | 148.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|