C36H41BrN4O6SSi — CID 10509372
S-pyridin-4-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate (PubChem CID 10509372) has the molecular formula C36H41BrN4O6SSi and a molecular weight of 765.80 g/mol. Its IUPAC name is S-pyridin-4-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate.
| Compound Name | S-pyridin-4-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate |
|---|---|
| PubChem CID | 10509372 |
| Molecular Formula | C36H41BrN4O6SSi |
| Molecular Weight | 765.80 g/mol |
| Exact Mass | 764.17 |
| IUPAC Name | S-pyridin-4-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate |
| SMILES | COc1cc2cc(C(=O)N3CC(CBr)c4c3cc(O[Si](C)(C)C(C)(C)C)c3[nH]c(C)c(C(=O)Sc5ccncc5)c43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C36H41BrN4O6SSi/c1-19-27(35(43)48-22-10-12-38-13-11-22)29-28-21(17-37)18-41(24(28)16-25(31(29)39-19)47-49(8,9)36(2,3)4)34(42)23-14-20-15-26(44-5)32(45-6)33(46-7)30(20)40-23/h10-16,21,39-40H,17-18H2,1-9H3 |
| InChIKey | WOYVRRKFVIYNKE-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.80 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|