C41H44BrN3O6SSi — CID 10581268
S-naphthalen-2-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate (PubChem CID 10581268) has the molecular formula C41H44BrN3O6SSi and a molecular weight of 814.88 g/mol. Its IUPAC name is S-naphthalen-2-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate.
| Compound Name | S-naphthalen-2-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate |
|---|---|
| PubChem CID | 10581268 |
| Molecular Formula | C41H44BrN3O6SSi |
| Molecular Weight | 814.88 g/mol |
| Exact Mass | 813.19 |
| IUPAC Name | S-naphthalen-2-yl 8-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carbothioate |
| SMILES | COc1cc2cc(C(=O)N3CC(CBr)c4c3cc(O[Si](C)(C)C(C)(C)C)c3[nH]c(C)c(C(=O)Sc5ccc6ccccc6c5)c43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C41H44BrN3O6SSi/c1-22-32(40(47)52-27-15-14-23-12-10-11-13-24(23)16-27)34-33-26(20-42)21-45(29(33)19-30(36(34)43-22)51-53(8,9)41(2,3)4)39(46)28-17-25-18-31(48-5)37(49-6)38(50-7)35(25)44-28/h10-19,26,43-44H,20-21H2,1-9H3 |
| InChIKey | KSKUQNQRULLNRN-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.88 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|