C29H35ClN5O10PS — CID 46185226
2-[[1-(chloromethyl)-3-[4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]-5-nitro-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate (PubChem CID 46185226) has the molecular formula C29H35ClN5O10PS and a molecular weight of 712.12 g/mol. Its IUPAC name is 2-[[1-(chloromethyl)-3-[4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]-5-nitro-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate.
| Compound Name | 2-[[1-(chloromethyl)-3-[4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]-5-nitro-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 46185226 |
| Molecular Formula | C29H35ClN5O10PS |
| Molecular Weight | 712.12 g/mol |
| Exact Mass | 711.15 |
| IUPAC Name | 2-[[1-(chloromethyl)-3-[4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]-5-nitro-1,2-dihydrobenzo[e]indol-7-yl]sulfonylamino]ethyl dihydrogen phosphate |
| SMILES | CN1CCN(CCOc2ccc(C(=O)N3CC(CCl)c4c3cc([N+](=O)[O-])c3cc(S(=O)(=O)NCCOP(=O)(O)O)ccc43)cc2)CC1 |
| InChI | InChI=1S/C29H35ClN5O10PS/c1-32-9-11-33(12-10-32)13-15-44-22-4-2-20(3-5-22)29(36)34-19-21(18-30)28-24-7-6-23(16-25(24)26(35(37)38)17-27(28)34)47(42,43)31-8-14-45-46(39,40)41/h2-7,16-17,21,31H,8-15,18-19H2,1H3,(H2,39,40,41) |
| InChIKey | IZKAIRGMRHPZJU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 192.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|