C27H24ClN5O4 — CID 11548090
1-(chloromethyl)-3-[5-[2-(dimethylamino)ethoxy]-1H-indole-2-carbonyl]-5-nitro-1,2-dihydrobenzo[e]indole-7-carbonitrile (PubChem CID 11548090) has the molecular formula C27H24ClN5O4 and a molecular weight of 517.97 g/mol. Its IUPAC name is 1-(chloromethyl)-3-[5-[2-(dimethylamino)ethoxy]-1H-indole-2-carbonyl]-5-nitro-1,2-dihydrobenzo[e]indole-7-carbonitrile.
| Compound Name | 1-(chloromethyl)-3-[5-[2-(dimethylamino)ethoxy]-1H-indole-2-carbonyl]-5-nitro-1,2-dihydrobenzo[e]indole-7-carbonitrile |
|---|---|
| PubChem CID | 11548090 |
| Molecular Formula | C27H24ClN5O4 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 1-(chloromethyl)-3-[5-[2-(dimethylamino)ethoxy]-1H-indole-2-carbonyl]-5-nitro-1,2-dihydrobenzo[e]indole-7-carbonitrile |
| SMILES | CN(C)CCOc1ccc2[nH]c(C(=O)N3CC(CCl)c4c3cc([N+](=O)[O-])c3cc(C#N)ccc43)cc2c1 |
| InChI | InChI=1S/C27H24ClN5O4/c1-31(2)7-8-37-19-4-6-22-17(10-19)11-23(30-22)27(34)32-15-18(13-28)26-20-5-3-16(14-29)9-21(20)24(33(35)36)12-25(26)32/h3-6,9-12,18,30H,7-8,13,15H2,1-2H3 |
| InChIKey | DKJMAWIEBGBFPH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|