C26H22ClN3O5 — CID 10648820
(1R)-1-(chloromethyl)-5-hydroxy-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indole-8-carbonitrile (PubChem CID 10648820) has the molecular formula C26H22ClN3O5 and a molecular weight of 491.93 g/mol. Its IUPAC name is (1R)-1-(chloromethyl)-5-hydroxy-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indole-8-carbonitrile.
| Compound Name | (1R)-1-(chloromethyl)-5-hydroxy-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indole-8-carbonitrile |
|---|---|
| PubChem CID | 10648820 |
| Molecular Formula | C26H22ClN3O5 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (1R)-1-(chloromethyl)-5-hydroxy-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indole-8-carbonitrile |
| SMILES | COc1cc2cc(C(=O)N3C[C@H](CCl)c4c3cc(O)c3ccc(C#N)cc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C26H22ClN3O5/c1-33-21-8-14-7-18(29-23(14)25(35-3)24(21)34-2)26(32)30-12-15(10-27)22-17-6-13(11-28)4-5-16(17)20(31)9-19(22)30/h4-9,15,29,31H,10,12H2,1-3H3/t15-/m0/s1 |
| InChIKey | XEOWYZQEQLGBIN-HNNXBMFYSA-N |
| XLogP | 4.91 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|