About CID 21030644
CID 21030644 (PubChem CID 21030644) has the molecular formula C28H26BClN4O5
and a molecular weight of 544.80 g/mol.
Molecular Properties
| Compound Name | CID 21030644 |
| PubChem CID | 21030644 |
| Molecular Formula | C28H26BClN4O5 |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC/C=N/c1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1 |
| InChI | InChI=1S/C28H26BClN4O5/c1-37-22-11-15-10-20(33-24(15)26(39-3)25(22)38-2)27(35)34-14-16(13-30)23-18-7-5-4-6-17(18)19(12-21(23)34)31-8-9-32-28(29)36/h4-8,10-12,16,33H,9,13-14H2,1-3H3,(H,32,36)/b31-8+ |
| InChIKey | CIVPUXDIQOMEJH-OWNKRRAQSA-N |
| XLogP | 4.91 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 21030644 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21030644?
The IUPAC name of CID 21030644 (CID 21030644) is not available.
What is the SMILES notation for CID 21030644?
The canonical SMILES for CID 21030644 is [B]C(=O)NC/C=N/c1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1.
What is the InChIKey of CID 21030644?
The InChIKey is CIVPUXDIQOMEJH-OWNKRRAQSA-N. The full InChI is InChI=1S/C28H26BClN4O5/c1-37-22-11-15-10-20(33-24(15)26(39-3)25(22)38-2)27(35)34-14-16(13-30)23-18-7-5-4-6-17(18)19(12-21(23)34)31-8-9-32-28(29)36/h4-8,10-12,16,33H,9,13-14H2,1-3H3,(H,32,36)/b31-8+.
What are the key properties of CID 21030644?
CID 21030644 has a molecular weight of 544.80 g/mol, XLogP of 4.91, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21030644 is sourced from PubChem (CID 21030644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).