C28H26BClN4O5 — CID 21030644
CID 21030644 (PubChem CID 21030644) has the molecular formula C28H26BClN4O5 and a molecular weight of 544.80 g/mol.
| Compound Name | CID 21030644 |
|---|---|
| PubChem CID | 21030644 |
| Molecular Formula | C28H26BClN4O5 |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC/C=N/c1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1 |
| InChI | InChI=1S/C28H26BClN4O5/c1-37-22-11-15-10-20(33-24(15)26(39-3)25(22)38-2)27(35)34-14-16(13-30)23-18-7-5-4-6-17(18)19(12-21(23)34)31-8-9-32-28(29)36/h4-8,10-12,16,33H,9,13-14H2,1-3H3,(H,32,36)/b31-8+ |
| InChIKey | CIVPUXDIQOMEJH-OWNKRRAQSA-N |
| XLogP | 4.91 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|