C30H33ClN4O6 — CID 21143766
[3-(chloromethyl)-1-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3-dihydroindol-6-yl]-[[4-[hydroxy(oxido)amino]phenyl]methyl]-dimethylazanium (PubChem CID 21143766) has the molecular formula C30H33ClN4O6 and a molecular weight of 581.07 g/mol. Its IUPAC name is [3-(chloromethyl)-1-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3-dihydroindol-6-yl]-[[4-[hydroxy(oxido)amino]phenyl]methyl]-dimethylazanium.
| Compound Name | [3-(chloromethyl)-1-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3-dihydroindol-6-yl]-[[4-[hydroxy(oxido)amino]phenyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 21143766 |
| Molecular Formula | C30H33ClN4O6 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [3-(chloromethyl)-1-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3-dihydroindol-6-yl]-[[4-[hydroxy(oxido)amino]phenyl]methyl]-dimethylazanium |
| SMILES | COc1cc2cc(C(=O)N3CC(CCl)c4ccc([N+](C)(C)Cc5ccc(N([O-])O)cc5)cc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C30H33ClN4O6/c1-35(2,17-18-6-8-21(9-7-18)34(37)38)22-10-11-23-20(15-31)16-33(25(23)14-22)30(36)24-12-19-13-26(39-3)28(40-4)29(41-5)27(19)32-24/h6-14,20,32,37H,15-17H2,1-5H3 |
| InChIKey | UZBFMJPGIOKBHU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|