C60H51Cl2N3O6 — CID 118254401
9H-fluoren-9-ylmethyl N-[1,5-bis[(1S)-1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indol-3-yl]-1,5-dioxopentan-3-yl]carbamate (PubChem CID 118254401) has the molecular formula C60H51Cl2N3O6 and a molecular weight of 980.99 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[1,5-bis[(1S)-1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indol-3-yl]-1,5-dioxopentan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[1,5-bis[(1S)-1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indol-3-yl]-1,5-dioxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 118254401 |
| Molecular Formula | C60H51Cl2N3O6 |
| Molecular Weight | 980.99 g/mol |
| Exact Mass | 979.32 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[1,5-bis[(1S)-1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indol-3-yl]-1,5-dioxopentan-3-yl]carbamate |
| SMILES | O=C(NC(CC(=O)N1C[C@@H](CCl)c2c1cc(OCc1ccccc1)c1ccccc21)CC(=O)N1C[C@@H](CCl)c2c1cc(OCc1ccccc1)c1ccccc21)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C60H51Cl2N3O6/c61-31-40-33-64(52-29-54(69-35-38-15-3-1-4-16-38)47-23-11-13-25-49(47)58(40)52)56(66)27-42(63-60(68)71-37-51-45-21-9-7-19-43(45)44-20-8-10-22-46(44)51)28-57(67)65-34-41(32-62)59-50-26-14-12-24-48(50)55(30-53(59)65)70-36-39-17-5-2-6-18-39/h1-26,29-30,40-42,51H,27-28,31-37H2,(H,63,68)/t40-,41-/m1/s1 |
| InChIKey | MRNLCWQFCZHIEB-GYOJGHLZSA-N |
| XLogP | 12.88 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.99 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|