C19H14ClN3O4S — CID 139380545
[1-(chloromethyl)-3-(5-formyl-1,3,4-thiadiazole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 139380545) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is [1-(chloromethyl)-3-(5-formyl-1,3,4-thiadiazole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [1-(chloromethyl)-3-(5-formyl-1,3,4-thiadiazole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 139380545 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | [1-(chloromethyl)-3-(5-formyl-1,3,4-thiadiazole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1nnc(C=O)s1 |
| InChI | InChI=1S/C19H14ClN3O4S/c1-10(25)27-15-6-14-17(13-5-3-2-4-12(13)15)11(7-20)8-23(14)19(26)18-22-21-16(9-24)28-18/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | LCHSIRUSVWBHSD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|