C21H26ClNO5 — CID 10573469
tert-butyl (1S)-1-(chloromethyl)-6-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 10573469) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is tert-butyl (1S)-1-(chloromethyl)-6-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (1S)-1-(chloromethyl)-6-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 10573469 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | tert-butyl (1S)-1-(chloromethyl)-6-(hydroxymethyl)-5-(methoxymethoxy)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | COCOc1cc2c(c3cccc(CO)c13)[C@H](CCl)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26ClNO5/c1-21(2,3)28-20(25)23-10-14(9-22)18-15-7-5-6-13(11-24)19(15)17(8-16(18)23)27-12-26-4/h5-8,14,24H,9-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | MXBNKCURCQYSIH-CQSZACIVSA-N |
| XLogP | 4.39 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|