C29H26ClN3O5S — CID 118373088
tert-butyl 11-(chloromethyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-2-oxa-4,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),3,5,7,9,14-hexaene-13-carboxylate (PubChem CID 118373088) has the molecular formula C29H26ClN3O5S and a molecular weight of 564.06 g/mol. Its IUPAC name is tert-butyl 11-(chloromethyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-2-oxa-4,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),3,5,7,9,14-hexaene-13-carboxylate.
| Compound Name | tert-butyl 11-(chloromethyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-2-oxa-4,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),3,5,7,9,14-hexaene-13-carboxylate |
|---|---|
| PubChem CID | 118373088 |
| Molecular Formula | C29H26ClN3O5S |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | tert-butyl 11-(chloromethyl)-3-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-2-oxa-4,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),3,5,7,9,14-hexaene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCl)c2c1cc1c3c(cccc23)N=C(SCCN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C29H26ClN3O5S/c1-29(2,3)38-28(36)33-15-16(14-30)23-19-9-6-10-20-24(19)22(13-21(23)33)37-27(31-20)39-12-11-32-25(34)17-7-4-5-8-18(17)26(32)35/h4-10,13,16H,11-12,14-15H2,1-3H3 |
| InChIKey | HHYSMVITMKJYPJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|