C20H24ClNO3 — CID 10522627
tert-butyl (1S)-1-(chloromethyl)-7-hydroxy-1,2,3,4-tetrahydrobenzo[g][1]benzazepine-5-carboxylate (PubChem CID 10522627) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is tert-butyl (1S)-1-(chloromethyl)-7-hydroxy-1,2,3,4-tetrahydrobenzo[g][1]benzazepine-5-carboxylate.
| Compound Name | tert-butyl (1S)-1-(chloromethyl)-7-hydroxy-1,2,3,4-tetrahydrobenzo[g][1]benzazepine-5-carboxylate |
|---|---|
| PubChem CID | 10522627 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | tert-butyl (1S)-1-(chloromethyl)-7-hydroxy-1,2,3,4-tetrahydrobenzo[g][1]benzazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CCl)c2c1cc(O)c1ccccc21 |
| InChI | InChI=1S/C20H24ClNO3/c1-20(2,3)25-19(24)22-10-6-7-13(12-21)18-15-9-5-4-8-14(15)17(23)11-16(18)22/h4-5,8-9,11,13,23H,6-7,10,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | AEWLHPHGBHJFFS-CYBMUJFWSA-N |
| XLogP | 5.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|