C18H20ClNO3 — CID 10664394
tert-butyl (3S)-3-(chloromethyl)-4-hydroxy-2,3-dihydrobenzo[f]indole-1-carboxylate (PubChem CID 10664394) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is tert-butyl (3S)-3-(chloromethyl)-4-hydroxy-2,3-dihydrobenzo[f]indole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(chloromethyl)-4-hydroxy-2,3-dihydrobenzo[f]indole-1-carboxylate |
|---|---|
| PubChem CID | 10664394 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | tert-butyl (3S)-3-(chloromethyl)-4-hydroxy-2,3-dihydrobenzo[f]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CCl)c2c1cc1ccccc1c2O |
| InChI | InChI=1S/C18H20ClNO3/c1-18(2,3)23-17(22)20-10-12(9-19)15-14(20)8-11-6-4-5-7-13(11)16(15)21/h4-8,12,21H,9-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | MMVVMPIUQAMTGU-GFCCVEGCSA-N |
| XLogP | 4.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|