C28H32ClN3O5 — CID 118129635
tert-butyl 1-(chloromethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 118129635) has the molecular formula C28H32ClN3O5 and a molecular weight of 526.03 g/mol. Its IUPAC name is tert-butyl 1-(chloromethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl 1-(chloromethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 118129635 |
| Molecular Formula | C28H32ClN3O5 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | tert-butyl 1-(chloromethyl)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCl)c2c1cc(NC(=O)CCCCCN1C(=O)C=CC1=O)c1ccccc21 |
| InChI | InChI=1S/C28H32ClN3O5/c1-28(2,3)37-27(36)32-17-18(16-29)26-20-10-7-6-9-19(20)21(15-22(26)32)30-23(33)11-5-4-8-14-31-24(34)12-13-25(31)35/h6-7,9-10,12-13,15,18H,4-5,8,11,14,16-17H2,1-3H3,(H,30,33) |
| InChIKey | MMTAMSLLXZIJQV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|