C31H32ClN4O8P — CID 155063664
[1-(chloromethyl)-3-[1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethyl]-5-formylpyrrole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphite (PubChem CID 155063664) has the molecular formula C31H32ClN4O8P and a molecular weight of 655.04 g/mol. Its IUPAC name is [1-(chloromethyl)-3-[1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethyl]-5-formylpyrrole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphite.
| Compound Name | [1-(chloromethyl)-3-[1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethyl]-5-formylpyrrole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 155063664 |
| Molecular Formula | C31H32ClN4O8P |
| Molecular Weight | 655.04 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | [1-(chloromethyl)-3-[1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethyl]-5-formylpyrrole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphite |
| SMILES | O=Cc1ccc(C(=O)N2CC(CCl)c3c2cc(OP(O)O)c2ccccc32)n1CCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H32ClN4O8P/c32-17-20-18-36(25-16-26(44-45(42)43)22-6-3-4-7-23(22)30(20)25)31(41)24-10-9-21(19-37)34(24)15-13-33-27(38)8-2-1-5-14-35-28(39)11-12-29(35)40/h3-4,6-7,9-12,16,19-20,42-43H,1-2,5,8,13-15,17-18H2,(H,33,38) |
| InChIKey | WKHVXDCWZHBATQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 158.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|