C19H22ClNO4S — CID 145158651
tert-butyl 4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate (PubChem CID 145158651) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is tert-butyl 4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate.
| Compound Name | tert-butyl 4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate |
|---|---|
| PubChem CID | 145158651 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | tert-butyl 4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate |
| SMILES | CC(=O)Oc1cc2c(c3c(C)csc13)C(CCl)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22ClNO4S/c1-10-9-26-17-14(24-11(2)22)6-13-16(15(10)17)12(7-20)8-21(13)18(23)25-19(3,4)5/h6,9,12H,7-8H2,1-5H3 |
| InChIKey | YRUSSGPNOZTWDL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|