C15H14ClNO4S — CID 122529730
(8S)-4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylic acid (PubChem CID 122529730) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is (8S)-4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylic acid.
| Compound Name | (8S)-4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 122529730 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (8S)-4-acetyloxy-8-(chloromethyl)-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylic acid |
| SMILES | CC(=O)Oc1cc2c(c3c(C)csc13)[C@H](CCl)CN2C(=O)O |
| InChI | InChI=1S/C15H14ClNO4S/c1-7-6-22-14-11(21-8(2)18)3-10-13(12(7)14)9(4-16)5-17(10)15(19)20/h3,6,9H,4-5H2,1-2H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | XIBYZPGDRQPJPR-SECBINFHSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|