C19H24ClNO4S — CID 145158563
tert-butyl 4-acetyloxy-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate;chloromethane (PubChem CID 145158563) has the molecular formula C19H24ClNO4S and a molecular weight of 397.92 g/mol. Its IUPAC name is tert-butyl 4-acetyloxy-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate;chloromethane.
| Compound Name | tert-butyl 4-acetyloxy-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate;chloromethane |
|---|---|
| PubChem CID | 145158563 |
| Molecular Formula | C19H24ClNO4S |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl 4-acetyloxy-1-methyl-7,8-dihydrothieno[3,2-e]indole-6-carboxylate;chloromethane |
| SMILES | CC(=O)Oc1cc2c(c3c(C)csc13)CCN2C(=O)OC(C)(C)C.CCl |
| InChI | InChI=1S/C18H21NO4S.CH3Cl/c1-10-9-24-16-14(22-11(2)20)8-13-12(15(10)16)6-7-19(13)17(21)23-18(3,4)5;1-2/h8-9H,6-7H2,1-5H3;1H3 |
| InChIKey | CQPVMQHBHNLDEH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|