C20H24ClNO4 — CID 144891971
tert-butyl 5-acetyloxy-1,2-dihydrobenzo[e]indole-3-carboxylate;chloromethane (PubChem CID 144891971) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is tert-butyl 5-acetyloxy-1,2-dihydrobenzo[e]indole-3-carboxylate;chloromethane.
| Compound Name | tert-butyl 5-acetyloxy-1,2-dihydrobenzo[e]indole-3-carboxylate;chloromethane |
|---|---|
| PubChem CID | 144891971 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | tert-butyl 5-acetyloxy-1,2-dihydrobenzo[e]indole-3-carboxylate;chloromethane |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)CCN2C(=O)OC(C)(C)C.CCl |
| InChI | InChI=1S/C19H21NO4.CH3Cl/c1-12(21)23-17-11-16-14(13-7-5-6-8-15(13)17)9-10-20(16)18(22)24-19(2,3)4;1-2/h5-8,11H,9-10H2,1-4H3;1H3 |
| InChIKey | SPTIYASIUVRASW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|