C15H22N4O4 — CID 118017261
[4-[[(2R)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate (PubChem CID 118017261) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is [4-[[(2R)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2R)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 118017261 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [4-[[(2R)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@H](N)CCCNC(N)=O)cc1 |
| InChI | InChI=1S/C15H22N4O4/c1-10(20)23-9-11-4-6-12(7-5-11)19-14(21)13(16)3-2-8-18-15(17)22/h4-7,13H,2-3,8-9,16H2,1H3,(H,19,21)(H3,17,18,22)/t13-/m1/s1 |
| InChIKey | PRVQCOULXVUBSZ-CYBMUJFWSA-N |
| XLogP | 0.46 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|