C16H24N4O4 — CID 139354555
[4-[[(2S)-5-(carbamoylamino)-2-methylpentanoyl]amino]phenyl]methyl N-methylcarbamate (PubChem CID 139354555) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-methylpentanoyl]amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-methylpentanoyl]amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 139354555 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-methylpentanoyl]amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccc(NC(=O)[C@@H](C)CCCNC(N)=O)cc1 |
| InChI | InChI=1S/C16H24N4O4/c1-11(4-3-9-19-15(17)22)14(21)20-13-7-5-12(6-8-13)10-24-16(23)18-2/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,23)(H,20,21)(H3,17,19,22)/t11-/m0/s1 |
| InChIKey | OGFPTVOUHZDTIL-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|