C38H41ClN2O6 — CID 130458386
tert-butyl (1S)-5-butoxy-1-(chloromethyl)-7-(9H-fluoren-9-ylmethoxycarbonylamino)-9-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 130458386) has the molecular formula C38H41ClN2O6 and a molecular weight of 657.21 g/mol. Its IUPAC name is tert-butyl (1S)-5-butoxy-1-(chloromethyl)-7-(9H-fluoren-9-ylmethoxycarbonylamino)-9-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (1S)-5-butoxy-1-(chloromethyl)-7-(9H-fluoren-9-ylmethoxycarbonylamino)-9-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 130458386 |
| Molecular Formula | C38H41ClN2O6 |
| Molecular Weight | 657.21 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | tert-butyl (1S)-5-butoxy-1-(chloromethyl)-7-(9H-fluoren-9-ylmethoxycarbonylamino)-9-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CCCCOc1cc2c(c3c(OC)cc(NC(=O)OCC4c5ccccc5-c5ccccc54)cc13)[C@H](CCl)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H41ClN2O6/c1-6-7-16-45-32-19-31-34(23(20-39)21-41(31)37(43)47-38(2,3)4)35-29(32)17-24(18-33(35)44-5)40-36(42)46-22-30-27-14-10-8-12-25(27)26-13-9-11-15-28(26)30/h8-15,17-19,23,30H,6-7,16,20-22H2,1-5H3,(H,40,42)/t23-/m1/s1 |
| InChIKey | XUIQWDMZUNYZQM-HSZRJFAPSA-N |
| XLogP | 9.47 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.21 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|