C26H36F3NO3 — CID 122399047
tert-butyl (3S,4S)-3-nonyl-2-oxo-4-phenyl-6-(trifluoromethyl)-3,4-dihydropyridine-1-carboxylate (PubChem CID 122399047) has the molecular formula C26H36F3NO3 and a molecular weight of 467.57 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-nonyl-2-oxo-4-phenyl-6-(trifluoromethyl)-3,4-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-nonyl-2-oxo-4-phenyl-6-(trifluoromethyl)-3,4-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 122399047 |
| Molecular Formula | C26H36F3NO3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | tert-butyl (3S,4S)-3-nonyl-2-oxo-4-phenyl-6-(trifluoromethyl)-3,4-dihydropyridine-1-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1C(=O)N(C(=O)OC(C)(C)C)C(C(F)(F)F)=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H36F3NO3/c1-5-6-7-8-9-10-14-17-20-21(19-15-12-11-13-16-19)18-22(26(27,28)29)30(23(20)31)24(32)33-25(2,3)4/h11-13,15-16,18,20-21H,5-10,14,17H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | RXRSXLDWJOWBGM-LEWJYISDSA-N |
| XLogP | 7.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|