C22H31NO4 — CID 139038611
tert-butyl (1R,2R,3S)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-3-pentylcyclopropane-1-carboxylate (PubChem CID 139038611) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl (1R,2R,3S)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-3-pentylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl (1R,2R,3S)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-3-pentylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139038611 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl (1R,2R,3S)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-3-pentylcyclopropane-1-carboxylate |
| SMILES | CCCCC[C@H]1[C@@H](C(=O)OC(C)(C)C)[C@@H]1N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c1-5-6-8-13-16-18(20(24)27-22(2,3)4)19(16)23-17(14-26-21(23)25)15-11-9-7-10-12-15/h7,9-12,16-19H,5-6,8,13-14H2,1-4H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | KMARFAXPUIGEON-INDMIFKZSA-N |
| XLogP | 4.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|