C24H30N2O2 — CID 15468887
(4R,6R,8R)-8-hexyl-4,6-diphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one (PubChem CID 15468887) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (4R,6R,8R)-8-hexyl-4,6-diphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one.
| Compound Name | (4R,6R,8R)-8-hexyl-4,6-diphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one |
|---|---|
| PubChem CID | 15468887 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (4R,6R,8R)-8-hexyl-4,6-diphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one |
| SMILES | CCCCCC[C@@H]1C[C@H](c2ccccc2)N2[C@H](c3ccccc3)COC(=O)N12 |
| InChI | InChI=1S/C24H30N2O2/c1-2-3-4-11-16-21-17-22(19-12-7-5-8-13-19)26-23(18-28-24(27)25(21)26)20-14-9-6-10-15-20/h5-10,12-15,21-23H,2-4,11,16-18H2,1H3/t21-,22-,23+/m1/s1 |
| InChIKey | FPPVYCXUFPYEKS-ZLNRFVROSA-N |
| XLogP | 5.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|