C17H20N2O7 — CID 101345822
diethyl (8R)-5-oxo-8-phenyl-1,3,7,8-tetrahydro-[1,3,4]oxadiazolo[3,4-c][1,3,4]oxadiazine-1,3-dicarboxylate (PubChem CID 101345822) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is diethyl (8R)-5-oxo-8-phenyl-1,3,7,8-tetrahydro-[1,3,4]oxadiazolo[3,4-c][1,3,4]oxadiazine-1,3-dicarboxylate.
| Compound Name | diethyl (8R)-5-oxo-8-phenyl-1,3,7,8-tetrahydro-[1,3,4]oxadiazolo[3,4-c][1,3,4]oxadiazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101345822 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | diethyl (8R)-5-oxo-8-phenyl-1,3,7,8-tetrahydro-[1,3,4]oxadiazolo[3,4-c][1,3,4]oxadiazine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1OC(C(=O)OCC)N2[C@H](c3ccccc3)COC(=O)N12 |
| InChI | InChI=1S/C17H20N2O7/c1-3-23-15(20)13-18-12(11-8-6-5-7-9-11)10-25-17(22)19(18)14(26-13)16(21)24-4-2/h5-9,12-14H,3-4,10H2,1-2H3/t12-,13?,14?/m0/s1 |
| InChIKey | ZDQMMLHBMWMEAD-HSBZDZAISA-N |
| XLogP | 1.21 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|