C15H14N3O6+ — CID 11759333
(Z)-3-[(5R)-2,3-dioxo-5-phenylmorpholin-4-yl]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 11759333) has the molecular formula C15H14N3O6+ and a molecular weight of 332.29 g/mol. Its IUPAC name is (Z)-3-[(5R)-2,3-dioxo-5-phenylmorpholin-4-yl]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (Z)-3-[(5R)-2,3-dioxo-5-phenylmorpholin-4-yl]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11759333 |
| Molecular Formula | C15H14N3O6+ |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (Z)-3-[(5R)-2,3-dioxo-5-phenylmorpholin-4-yl]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | CCO/C(O)=C(\[N+]#N)C(=O)N1C(=O)C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13N3O6/c1-2-23-14(21)11(17-16)12(19)18-10(8-24-15(22)13(18)20)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | AYBGXBLUHSSKPV-JTQLQIEISA-O |
| XLogP | 1.26 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|