C14H19NO4S — CID 153315857
ethyl 4-[(4R)-2-oxo-4-phenyloxathiazolidin-3-yl]butanoate (PubChem CID 153315857) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 4-[(4R)-2-oxo-4-phenyloxathiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(4R)-2-oxo-4-phenyloxathiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 153315857 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl 4-[(4R)-2-oxo-4-phenyloxathiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1[C@H](c2ccccc2)COS1=O |
| InChI | InChI=1S/C14H19NO4S/c1-2-18-14(16)9-6-10-15-13(11-19-20(15)17)12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3/t13-,20?/m0/s1 |
| InChIKey | WQSZJWQXFROPHT-SZQRVLIRSA-N |
| XLogP | 1.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |