C22H23NO5 — CID 11058025
ethyl 3-oxo-3-[(2R,4R)-4-phenyl-2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-3-yl]propanoate (PubChem CID 11058025) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 3-oxo-3-[(2R,4R)-4-phenyl-2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-3-yl]propanoate.
| Compound Name | ethyl 3-oxo-3-[(2R,4R)-4-phenyl-2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 11058025 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl 3-oxo-3-[(2R,4R)-4-phenyl-2-[(2R,3S)-3-phenyloxiran-2-yl]-1,3-oxazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)CC(=O)N1[C@@H]([C@@H]2O[C@H]2c2ccccc2)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-2-26-19(25)13-18(24)23-17(15-9-5-3-6-10-15)14-27-22(23)21-20(28-21)16-11-7-4-8-12-16/h3-12,17,20-22H,2,13-14H2,1H3/t17-,20-,21+,22+/m0/s1 |
| InChIKey | BEOGVMLPGWWKMB-GUGJDKNPSA-N |
| XLogP | 3.01 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|