C22H26N2O3 — CID 101128972
(2S,4S)-2-[(2S,3R)-3-ethyl-3-methyloxiran-2-yl]-N-methyl-N,4-diphenyl-1,3-oxazolidine-3-carboxamide (PubChem CID 101128972) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2S,4S)-2-[(2S,3R)-3-ethyl-3-methyloxiran-2-yl]-N-methyl-N,4-diphenyl-1,3-oxazolidine-3-carboxamide.
| Compound Name | (2S,4S)-2-[(2S,3R)-3-ethyl-3-methyloxiran-2-yl]-N-methyl-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 101128972 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (2S,4S)-2-[(2S,3R)-3-ethyl-3-methyloxiran-2-yl]-N-methyl-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
| SMILES | CC[C@@]1(C)O[C@@H]1[C@@H]1OC[C@H](c2ccccc2)N1C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-22(2)19(27-22)20-24(18(15-26-20)16-11-7-5-8-12-16)21(25)23(3)17-13-9-6-10-14-17/h5-14,18-20H,4,15H2,1-3H3/t18-,19-,20+,22-/m1/s1 |
| InChIKey | XDAXPZALCPCLDT-XWSHUIEDSA-N |
| XLogP | 4.21 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|