C21H24N2O2 — CID 15548412
(2S,4S)-N-methyl-2-(2-methylprop-1-enyl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide (PubChem CID 15548412) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (2S,4S)-N-methyl-2-(2-methylprop-1-enyl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide.
| Compound Name | (2S,4S)-N-methyl-2-(2-methylprop-1-enyl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 15548412 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (2S,4S)-N-methyl-2-(2-methylprop-1-enyl)-N,4-diphenyl-1,3-oxazolidine-3-carboxamide |
| SMILES | CC(C)=C[C@@H]1OC[C@H](c2ccccc2)N1C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-16(2)14-20-23(19(15-25-20)17-10-6-4-7-11-17)21(24)22(3)18-12-8-5-9-13-18/h4-14,19-20H,15H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | LIHZBSXRYPRPLB-UXHICEINSA-N |
| XLogP | 4.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|