C18H25NO3 — CID 15548409
tert-butyl (2S,4S)-2-(2-methylprop-1-enyl)-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15548409) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(2-methylprop-1-enyl)-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(2-methylprop-1-enyl)-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15548409 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl (2S,4S)-2-(2-methylprop-1-enyl)-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)=C[C@@H]1OC[C@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO3/c1-13(2)11-16-19(17(20)22-18(3,4)5)15(12-21-16)14-9-7-6-8-10-14/h6-11,15-16H,12H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | XZLJKQNLODHGHX-CVEARBPZSA-N |
| XLogP | 4.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|