C28H45NO6Si — CID 15469064
tert-butyl (2R,4R)-2-[(E,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-5-oxopent-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15469064) has the molecular formula C28H45NO6Si and a molecular weight of 519.76 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(E,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-5-oxopent-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(E,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-5-oxopent-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15469064 |
| Molecular Formula | C28H45NO6Si |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(E,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-5-oxopent-1-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)C[C@H](/C=C/[C@H]1OC[C@@H](c2ccccc2)N1C(=O)OC(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H45NO6Si/c1-10-32-25(30)18-21(19-34-36(8,9)28(5,6)7)16-17-24-29(26(31)35-27(2,3)4)23(20-33-24)22-14-12-11-13-15-22/h11-17,21,23-24H,10,18-20H2,1-9H3/b17-16+/t21-,23-,24+/m0/s1 |
| InChIKey | AUOINNOEBCFDKG-OMHKLHDYSA-N |
| XLogP | 6.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|