C30H48N2O7Si — CID 11330647
tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-[(1R)-3-ethoxy-3-oxo-1-(prop-2-enoxycarbonylamino)propyl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 11330647) has the molecular formula C30H48N2O7Si and a molecular weight of 576.81 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-[(1R)-3-ethoxy-3-oxo-1-(prop-2-enoxycarbonylamino)propyl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-[(1R)-3-ethoxy-3-oxo-1-(prop-2-enoxycarbonylamino)propyl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11330647 |
| Molecular Formula | C30H48N2O7Si |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | tert-butyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[4-[(1R)-3-ethoxy-3-oxo-1-(prop-2-enoxycarbonylamino)propyl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N[C@H](CC(=O)OCC)c1ccc([C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H48N2O7Si/c1-11-17-37-27(34)31-24(19-26(33)36-12-2)21-13-15-22(16-14-21)25-18-23(39-40(9,10)30(6,7)8)20-32(25)28(35)38-29(3,4)5/h11,13-16,23-25H,1,12,17-20H2,2-10H3,(H,31,34)/t23-,24-,25-/m1/s1 |
| InChIKey | DMGZRFAARDZHJT-UBFVSLLYSA-N |
| XLogP | 6.67 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|