C35H45NO4Si — CID 11766964
tert-butyl (2R,4R)-2-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypent-4-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11766964) has the molecular formula C35H45NO4Si and a molecular weight of 571.83 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypent-4-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypent-4-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11766964 |
| Molecular Formula | C35H45NO4Si |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypent-4-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC[C@@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H45NO4Si/c1-8-9-25-31(32-36(33(37)39-34(2,3)4)30(26-38-32)27-19-13-10-14-20-27)40-41(35(5,6)7,28-21-15-11-16-22-28)29-23-17-12-18-24-29/h8,10-24,30-32H,1,9,25-26H2,2-7H3/t30-,31+,32+/m0/s1 |
| InChIKey | NGGWTUPBPSBION-DCMFLLSESA-N |
| XLogP | 7.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|