C24H39NO5Si — CID 15445289
tert-butyl (2R,4R)-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15445289) has the molecular formula C24H39NO5Si and a molecular weight of 449.66 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15445289 |
| Molecular Formula | C24H39NO5Si |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C(O)/C=C/CO[Si](C)(C)C(C)(C)C)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H39NO5Si/c1-23(2,3)30-22(27)25-19(18-13-10-9-11-14-18)17-28-21(25)20(26)15-12-16-29-31(7,8)24(4,5)6/h9-15,19-21,26H,16-17H2,1-8H3/b15-12+/t19-,20?,21+/m0/s1 |
| InChIKey | GKXCRKOEXLSYPK-PACMUCQDSA-N |
| XLogP | 5.26 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|