C23H37NO3Si — CID 71484143
tert-butyl (2S,3S)-1-benzyl-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]aziridine-2-carboxylate (PubChem CID 71484143) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is tert-butyl (2S,3S)-1-benzyl-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]aziridine-2-carboxylate.
| Compound Name | tert-butyl (2S,3S)-1-benzyl-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 71484143 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl (2S,3S)-1-benzyl-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]aziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-22(2,3)27-21(25)20-19(24(20)17-18-13-10-9-11-14-18)15-12-16-26-28(7,8)23(4,5)6/h9-15,19-20H,16-17H2,1-8H3/b15-12+/t19-,20-,24?/m0/s1 |
| InChIKey | VPOGEZCCOXCXKT-OYGBFJEPSA-N |
| XLogP | 5.16 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|